Information card for entry 2210307
| Chemical name |
9-(3,4-Dimethoxyphenyl)-4-p-tolyl-4,5,6,7-tetrahydrofuro[3,4-b]quinoline- 1,8(3H,9H)-dione |
| Formula |
C26 H25 N O5 |
| Calculated formula |
C26 H25 N O5 |
| SMILES |
O1CC2=C(C1=O)C(C1=C(N2c2ccc(cc2)C)CCCC1=O)c1cc(OC)c(OC)cc1 |
| Title of publication |
9-(3,4-Dimethoxyphenyl)-4-<i>p</i>-tolyl-4,5,6,7-tetrahydrofuro[3,4-<i>b</i>]quinoline-1,8(3<i>H</i>,9<i>H</i>)-dione |
| Authors of publication |
Shu-Jiang Tu; Yan Zhang; Run-Hong Jia |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
9 |
| Pages of publication |
o3873 - o3874 |
| a |
8.427 ± 0.009 Å |
| b |
11.453 ± 0.012 Å |
| c |
11.579 ± 0.012 Å |
| α |
95.909 ± 0.014° |
| β |
100.87 ± 0.013° |
| γ |
94.902 ± 0.015° |
| Cell volume |
1085 ± 2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1347 |
| Residual factor for significantly intense reflections |
0.0596 |
| Weighted residual factors for significantly intense reflections |
0.1203 |
| Weighted residual factors for all reflections included in the refinement |
0.1531 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.985 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210307.html