Information card for entry 2210373
| Chemical name |
1,2-Bis[5-(3,4-difluorophenyl)-2-methyl-3-thienyl]-3,3,4,4,5,5- hexafluorocyclopent-1-ene |
| Formula |
C27 H14 F10 S2 |
| Calculated formula |
C27 H14 F10 S2 |
| SMILES |
s1c(c(C2=C(c3cc(sc3C)c3ccc(F)c(F)c3)C(F)(F)C(F)(F)C2(F)F)cc1c1ccc(F)c(F)c1)C |
| Title of publication |
1,2-Bis[5-(3,4-difluorophenyl)-2-methyl-3-thienyl]-3,3,4,4,5,5-hexafluorocyclopent-1-ene |
| Authors of publication |
Liu, Gang; Pu, Shou-Zhi; Xu, Jing-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
9 |
| Pages of publication |
o4123 - o4125 |
| a |
19.126 ± 0.004 Å |
| b |
12.098 ± 0.003 Å |
| c |
21.528 ± 0.005 Å |
| α |
90° |
| β |
93.876 ± 0.004° |
| γ |
90° |
| Cell volume |
4970 ± 2 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1006 |
| Residual factor for significantly intense reflections |
0.0523 |
| Weighted residual factors for significantly intense reflections |
0.1251 |
| Weighted residual factors for all reflections included in the refinement |
0.1521 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210373.html