Information card for entry 2210733
| Chemical name |
[7,16-Bis(benzyloxycarbonyl)-6,18,15,17- tetramethyldibenzo[b,i][1,4,8,11]tetraazacyclotetradecinato-κ^4^N]nickel(II) |
| Formula |
C38 H34 N4 Ni O4 |
| Calculated formula |
C38 H34 N4 Ni O4 |
| SMILES |
[Ni]123[N]4=C(C(=C(N1c1c([N]2=C(C(=C(N3c2c4cccc2)C)C(=O)OCc2ccccc2)C)cccc1)C)C(=O)OCc1ccccc1)C |
| Title of publication |
[7,16-Bis(benzyloxycarbonyl)-6,18,15,17-tetramethyldibenzo[<i>b</i>,<i>i</i>][1,4,8,11]tetraazacyclotetradecinato-κ^4^<i>N</i>]nickel(II) |
| Authors of publication |
Boyd, Peter D.W.; Challis, J.B.; Rickard, C.E.F. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
10 |
| Pages of publication |
m2732 - m2734 |
| a |
10.6079 ± 0.0002 Å |
| b |
40.5916 ± 0.0002 Å |
| c |
14.8774 ± 0.0002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
6406.08 ± 0.15 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0477 |
| Residual factor for significantly intense reflections |
0.0373 |
| Weighted residual factors for significantly intense reflections |
0.0935 |
| Weighted residual factors for all reflections included in the refinement |
0.1037 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.847 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210733.html