Information card for entry 2210746
| Chemical name |
5,7,12,14-Tetrahydro[2,3-b]quinolinoacridine (β form) |
| Formula |
C20 H12 N2 O2 |
| Calculated formula |
C20 H12 N2 O2 |
| SMILES |
c1cccc2c1C(=O)c1c(N2)cc2c(Nc3ccccc3C2=O)c1 |
| Title of publication |
5,7,12,14-Tetrahydro[2,3-<i>b</i>]quinolinoacridine (β form) |
| Authors of publication |
Nishimura, Naoko; Senju, Takatoshi; Mizuguchi, Jin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
10 |
| Pages of publication |
o4683 - o4685 |
| a |
5.7366 ± 0.0006 Å |
| b |
3.8851 ± 0.0004 Å |
| c |
29.88 ± 0.004 Å |
| α |
90° |
| β |
95.861 ± 0.008° |
| γ |
90° |
| Cell volume |
662.46 ± 0.13 Å3 |
| Cell temperature |
296.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.1602 |
| Weighted residual factors for all reflections included in the refinement |
0.4313 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210746.html