Information card for entry 2210770
| Chemical name |
5-(2-Bromo-5-methoxyphenyl)-1,3,4-oxadiazol-2-amine |
| Formula |
C9 H8 Br N3 O2 |
| Calculated formula |
C9 H8 Br N3 O2 |
| SMILES |
Brc1c(c2oc(nn2)N)cc(cc1)OC |
| Title of publication |
5-(2-Bromo-5-methoxyphenyl)-1,3,4-oxadiazol-2-amine |
| Authors of publication |
Yathirajan, H. S.; Bindya, S.; Ashalatha, B. V.; Narayana, B.; Bolte, Michael |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
10 |
| Pages of publication |
o4442 - o4443 |
| a |
18.1501 ± 0.0019 Å |
| b |
10.3513 ± 0.0007 Å |
| c |
11.0955 ± 0.001 Å |
| α |
90° |
| β |
95.298 ± 0.008° |
| γ |
90° |
| Cell volume |
2075.7 ± 0.3 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0909 |
| Residual factor for significantly intense reflections |
0.0733 |
| Weighted residual factors for significantly intense reflections |
0.2069 |
| Weighted residual factors for all reflections included in the refinement |
0.2201 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210770.html