Information card for entry 2210797
| Chemical name |
(8S)-3-(2-Deoxy-3,5-di-O-p-toluoyl-α-D-erythro-pentafuranosyl)-3,6,7,8- tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol |
| Formula |
C27 H28 N4 O6 |
| Calculated formula |
C27 H28 N4 O6 |
| SMILES |
O1[C@@H]([C@@H](OC(=O)c2ccc(cc2)C)C[C@H]1n1cnc2[C@@H](O)CNC=Nc12)COC(=O)c1ccc(cc1)C |
| Title of publication |
(8<i>S</i>)-3-(2-Deoxy-3,5-di-<i>O</i>-<i>p</i>-toluoyl-α-<small>D</small>-<i>erythro</i>-pentofuranosyl)-3,6,7,8-tetrahydroimidazo[4,5-<i>d</i>][1,3]diazepin-8-ol |
| Authors of publication |
Li-Ping Gao; Ping-Dong Wu; Xiu-Rong Hu; Jian-Ming Gu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
10 |
| Pages of publication |
o4216 - o4218 |
| a |
10.492 ± 0.002 Å |
| b |
12.849 ± 0.003 Å |
| c |
18.645 ± 0.005 Å |
| α |
90° |
| β |
97.949 ± 0.01° |
| γ |
90° |
| Cell volume |
2489.4 ± 1 Å3 |
| Cell temperature |
296 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for all reflections included in the refinement |
0.06 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210797.html