Information card for entry 2210871
| Chemical name |
Bis[1-(4-nitrobenzyl)pyridinium] bis(2,2-dicyanoethylene-1,1-dithiolato-κ^2^S,S')nickel(II) |
| Formula |
C32 H22 N8 Ni O4 S4 |
| Calculated formula |
C32 H22 N8 Ni O4 S4 |
| SMILES |
C1(=C(C#N)C#N)S[Ni]2(S1)SC(=C(C#N)C#N)S2.[n+]1(ccccc1)Cc1ccc(cc1)N(=O)=O.c1cc(ccc1C[n+]1ccccc1)N(=O)=O |
| Title of publication |
Bis[1-(4-nitrobenzyl)pyridinium] bis(2,2-dicyanoethylene-1,1-dithiolato-κ^2^<i>S</i>,<i>S</i>')nickelate(II) |
| Authors of publication |
Liu, Ming-Guo; Li, Xiao-Yan; Lin, Li-Fa; Ni, Chun-Lin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
11 |
| Pages of publication |
m2919 - m2921 |
| a |
9.825 ± 0.001 Å |
| b |
12.092 ± 0.001 Å |
| c |
14.66 ± 0.002 Å |
| α |
90° |
| β |
100.11 ± 0.01° |
| γ |
90° |
| Cell volume |
1714.6 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1178 |
| Residual factor for significantly intense reflections |
0.0536 |
| Weighted residual factors for significantly intense reflections |
0.0825 |
| Weighted residual factors for all reflections included in the refinement |
0.095 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.849 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210871.html