Information card for entry 2213212
| Common name |
3,6,9-trimethyl-2,3-dihydrobenzo[de]chromene-7,8-dione |
| Chemical name |
3,6,9-trimethyl-2,3-dihydrobenzo[de]chromene-7,8-dione |
| Formula |
C15 H14 O3 |
| Calculated formula |
C15 H14 O3 |
| SMILES |
O1C2=C(C(=O)C(=O)c3c2c(ccc3C)[C@H](C1)C)C |
| Title of publication |
3,6,9-Trimethyl-2,3-dihydrobenzo[<i>de</i>]chromene-7,8-dione |
| Authors of publication |
Hoong-Kun Fun; Sompong Boonsri; Suchada Chantrapromma; Nawong Boonnak; Chatchanok Karalai |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
o2127 - o2129 |
| a |
7.1615 ± 0.0001 Å |
| b |
18.6558 ± 0.0003 Å |
| c |
18.0323 ± 0.0003 Å |
| α |
90° |
| β |
98.216 ± 0.001° |
| γ |
90° |
| Cell volume |
2384.45 ± 0.06 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.1133 |
| Residual factor for significantly intense reflections |
0.0614 |
| Weighted residual factors for significantly intense reflections |
0.1321 |
| Weighted residual factors for all reflections included in the refinement |
0.1664 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.011 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213212.html