Information card for entry 2213335
| Chemical name |
1,3,4,6-Tetra-O-acetyl-2-O-methylsulfonyl-α-D-mannopyranoside |
| Formula |
C15 H22 O12 S |
| Calculated formula |
C15 H22 O12 S |
| SMILES |
S(=O)(=O)(O[C@H]1[C@@H](OC(=O)C)[C@H](OC(=O)C)[C@H](O[C@@H]1OC(=O)C)COC(=O)C)C |
| Title of publication |
(1<i>S</i>,3<i>R</i>,4<i>R</i>)-1,3,4,6-Tetra-<i>O</i>-acetyl-2-<i>O</i>-methylsulfonyl-α-<small>D</small>-mannopyranoside |
| Authors of publication |
Liu, Chun-Yan; An, Qi; Li, Hui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
o2293 - o2294 |
| a |
8.947 ± 0.002 Å |
| b |
10.373 ± 0.003 Å |
| c |
22.477 ± 0.006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2086 ± 0.9 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0706 |
| Residual factor for significantly intense reflections |
0.0382 |
| Weighted residual factors for significantly intense reflections |
0.0792 |
| Weighted residual factors for all reflections included in the refinement |
0.0907 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.991 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213335.html