Information card for entry 2214297
| Chemical name |
(3S,5R,8R,9R,10R,13S,14R,17S)-Methyl 3β-acetoxy-17β-chloro-18-oxo-19,20,21,22,29,30-hexanorlupan-28-oate |
| Formula |
C27 H41 Cl O5 |
| Calculated formula |
C27 H41 Cl O5 |
| SMILES |
C1C[C@@H](C([C@@H]2CC[C@@]3([C@@H]([C@@]12C)CC[C@H]1[C@]3(CC[C@](C1=O)(C(=O)OC)Cl)C)C)(C)C)OC(=O)C |
| Title of publication |
(3<i>S</i>,5<i>R</i>,8<i>R</i>,9<i>R</i>,10<i>R</i>,13<i>S</i>,14<i>R</i>,17<i>S</i>)-Methyl 3β-acetoxy-17β-chloro-18-oxo-19,20,21,22,29,30-hexanorlupan-28-oate |
| Authors of publication |
Císařová, Ivana; Kvasnica, Miroslav; Sarek, Jan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
7 |
| Pages of publication |
o3145 - o3145 |
| a |
11.331 ± 0.003 Å |
| b |
6.738 ± 0.001 Å |
| c |
16.366 ± 0.003 Å |
| α |
90° |
| β |
96.275 ± 0.01° |
| γ |
90° |
| Cell volume |
1242 ± 0.4 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0467 |
| Residual factor for significantly intense reflections |
0.0384 |
| Weighted residual factors for significantly intense reflections |
0.0895 |
| Weighted residual factors for all reflections included in the refinement |
0.0962 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.102 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214297.html