Information card for entry 2214351
| Chemical name |
3-[2-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)ethyl] 5-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Formula |
C28 H28 Co N4 O16 S2 |
| Calculated formula |
C28 H28 Co N4 O16 S2 |
| SMILES |
c1c(ccc(c1)N(=O)=O)S(=O)(=O)CC(=O)[O-].c1(ccc(cc1)N(=O)=O)S(=O)(=O)CC(=O)O[Co]1([n]2cccc3ccc4ccc[n]1c4c23)([OH2])([OH2])[OH2].O |
| Title of publication |
Triaqua[(4-nitrophenylsulfonyl)acetato-κ<i>O</i>](1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')cobalt(II) (4-nitrophenylsulfonyl)acetate monohydrate |
| Authors of publication |
Hou, Yan-Jun; Yu, Ying-Hui; Sun, Zhi-Zhong; Li, Bai-Yan; Hou, Guang-Feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
7 |
| Pages of publication |
m1884 - m1884 |
| a |
7.571 ± 0.0012 Å |
| b |
15.75 ± 0.004 Å |
| c |
27.403 ± 0.005 Å |
| α |
90° |
| β |
96.76 ± 0.02° |
| γ |
90° |
| Cell volume |
3244.9 ± 1.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0544 |
| Residual factor for significantly intense reflections |
0.0392 |
| Weighted residual factors for significantly intense reflections |
0.0869 |
| Weighted residual factors for all reflections included in the refinement |
0.0907 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.067 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214351.html