Information card for entry 2214366
| Common name |
[<i>N</i>,<i>N</i>'-Bis(salicylidene)benzene-1,2-diaminato]iron(II) |
| Chemical name |
{2,2'-[o-phenylenebis(nitrilomethylidyne)]diphenolato}iron(II) |
| Formula |
C20 H14 Fe N2 O2 |
| Calculated formula |
C20 H14 Fe N2 O2 |
| SMILES |
c12ccccc1[N]1=Cc3ccccc3O[Fe]31[N]2=Cc1c(cccc1)O3 |
| Title of publication |
[<i>N</i>,<i>N</i>'-Bis(salicylidene)benzene-1,2-diaminato]iron(II) |
| Authors of publication |
Ye, Yong-Hao; Han, Yue; Chen, Ting-Ting; Liu, Chang-Hong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
7 |
| Pages of publication |
m1963 - m1963 |
| a |
5.4675 ± 0.001 Å |
| b |
16.616 ± 0.004 Å |
| c |
17.31 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1572.6 ± 0.5 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.076 |
| Residual factor for significantly intense reflections |
0.0544 |
| Weighted residual factors for significantly intense reflections |
0.1464 |
| Weighted residual factors for all reflections included in the refinement |
0.1697 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.689 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214366.html