Information card for entry 2215176
| Chemical name |
(2,2'-Bipyridine-κ^2^N,N')(3,5-dinitrosalicylato-κ^2^O^1^,O^2^)(pyridine- κN)copper(II) |
| Formula |
C22 H15 Cu N5 O7 |
| Calculated formula |
C22 H15 Cu N5 O7 |
| SMILES |
[Cu]12([n]3ccccc3c3[n]1cccc3)([n]1ccccc1)OC(=O)c1c(O2)c(N(=O)=O)cc(N(=O)=O)c1 |
| Title of publication |
(2,2'-Bipyridine-κ^2^<i>N</i>,<i>N</i>')(3,5-dinitrosalicylato-κ^2^<i>O</i>^1^,<i>O</i>^2^)(pyridine-κ<i>N</i>)copper(II) |
| Authors of publication |
Wen, De-Cai; Wu, Lin-Hua; Zhong, Chun-Long; Xie, Tian-Yang; Ta, Hong-Gui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
9 |
| Pages of publication |
m2362 - m2363 |
| a |
9.981 ± 0.002 Å |
| b |
10.269 ± 0.002 Å |
| c |
11.913 ± 0.002 Å |
| α |
68.99 ± 0.03° |
| β |
67.88 ± 0.03° |
| γ |
79.08 ± 0.03° |
| Cell volume |
1053.9 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0684 |
| Residual factor for significantly intense reflections |
0.0521 |
| Weighted residual factors for significantly intense reflections |
0.1334 |
| Weighted residual factors for all reflections included in the refinement |
0.1489 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215176.html