Information card for entry 2215367
| Chemical name |
4-(4-Chlorophenyl)-5-[2-methyl-1-(4-methylphenyl)-2-nitropropyl]-1,2,3- selenadiazole |
| Formula |
C19 H18 Cl N3 O2 Se |
| Calculated formula |
C19 H18 Cl N3 O2 Se |
| SMILES |
[se]1c(C(c2ccc(cc2)C)C(N(=O)=O)(C)C)c(c2ccc(Cl)cc2)nn1 |
| Title of publication |
4-(4-Chlorophenyl)-5-[2-methyl-1-(4-methylphenyl)-2-nitropropyl]-1,2,3-selenadiazole |
| Authors of publication |
Gunasekaran, B.; Manivannan, V.; Saravanan, S.; Muthusubramanian, S.; Nethaji, M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
10 |
| Pages of publication |
o4024 - o4024 |
| a |
13.346 ± 0.003 Å |
| b |
9.636 ± 0.002 Å |
| c |
14.887 ± 0.003 Å |
| α |
90° |
| β |
95.668 ± 0.004° |
| γ |
90° |
| Cell volume |
1905.1 ± 0.7 Å3 |
| Cell temperature |
290 ± 2 K |
| Ambient diffraction temperature |
290 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0797 |
| Residual factor for significantly intense reflections |
0.0441 |
| Weighted residual factors for significantly intense reflections |
0.0893 |
| Weighted residual factors for all reflections included in the refinement |
0.1023 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.009 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215367.html