Information card for entry 2215479
| Common name |
(3R*,1'S*,3'R*)-2-(2''-hydroxyethyl)-3- (3'-hydroxy-1'H,3'H- benzo[c]furan)-1'-yl-1H,3H-benzo[c]pyrrol-1-one |
| Chemical name |
(3<i>R</i>*,1'<i>S</i>*,3'<i>R</i>*)-3-(3'-Hydroxy-1'<i>H</i>,3'<i>H</i>- benzo[<i>c</i>]furan-1'-yl)-2-(2''-hydroxyethyl)-2,3-dihydro-1<i>H</i>- benzo[<i>c</i>]pyrrol-1-one |
| Formula |
C18 H17 N O4 |
| Calculated formula |
C18 H17 N O4 |
| SMILES |
C1(=O)N([C@H](c2c1cccc2)[C@H]1O[C@@H](c2c1cccc2)O)CCO |
| Title of publication |
(3<i>R</i>*,1'<i>S</i>*,3'<i>R</i>*)-3-(3'-Hydroxy-1'<i>H</i>,3'<i>H</i>-benzo[<i>c</i>]furan-1'-yl)-2-(2''-hydroxyethyl)-2,3-dihydro-1<i>H</i>-benzo[<i>c</i>]pyrrol-1-one |
| Authors of publication |
Urban, Jiří; Fábry, Jan; Zuman, Petr; Ludvík, Jiří; Císařová, Ivana |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
10 |
| Pages of publication |
o4139 - o4140 |
| a |
7.0292 ± 0.0001 Å |
| b |
11.9861 ± 0.0005 Å |
| c |
18.0014 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1516.67 ± 0.09 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0509 |
| Residual factor for significantly intense reflections |
0.0365 |
| Weighted residual factors for significantly intense reflections |
0.0663 |
| Weighted residual factors for all reflections included in the refinement |
0.0693 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.65 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215479.html