Information card for entry 2216537
| Chemical name |
1,5-Bis(2,6-dichlorophenyl)-3-[(1H-1,2,4-triazol-1-yl)methyl]penta-1,4-dien-3-ol |
| Formula |
C20 H15 Cl4 N3 O |
| Calculated formula |
C20 H15 Cl4 N3 O |
| SMILES |
Clc1c(c(Cl)ccc1)/C=C/C(O)(Cn1ncnc1)/C=C/c1c(Cl)cccc1Cl |
| Title of publication |
1,5-Bis(2,6-dichlorophenyl)-3-[(1<i>H</i>-1,2,4-triazol-1-yl)methyl]penta-1,4-dien-3-ol |
| Authors of publication |
Liang-Zhong Xu; Gong-Sheng Zhang; Xu Yi; Guang-Wei An; Zhong-Jie Xu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
12 |
| Pages of publication |
o4848 - o4848 |
| a |
8.3413 ± 0.0017 Å |
| b |
10.652 ± 0.002 Å |
| c |
22.229 ± 0.004 Å |
| α |
90° |
| β |
94.32 ± 0.03° |
| γ |
90° |
| Cell volume |
1969.5 ± 0.7 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0387 |
| Residual factor for significantly intense reflections |
0.0309 |
| Weighted residual factors for significantly intense reflections |
0.0768 |
| Weighted residual factors for all reflections included in the refinement |
0.0852 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.056 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2216537.html