Information card for entry 2216878
| Chemical name |
4-Methoxy-N-[6-methyl-2,3-dihydro-1,3-benzothiazol-2-ylidene]benzenesulfonamide |
| Formula |
C15 H14 N2 O3 S2 |
| Calculated formula |
C15 H14 N2 O3 S2 |
| SMILES |
c12c(ccc(c1)C)NC(=NS(=O)(=O)c1ccc(cc1)OC)S2 |
| Title of publication |
4-Methoxy-<i>N</i>-[6-methyl-2,3-dihydro-1,3-benzothiazol-2-ylidene]benzenesulfonamide |
| Authors of publication |
Navarrete-Vázquez, Gabriel; Moreno-Diaz, Hermenegilda; Villalobos-Molina, Rafael; Estrada-Soto, Samuel; Tlahuext, Hugo |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
1 |
| Pages of publication |
o227 - o227 |
| a |
12.0173 ± 0.0015 Å |
| b |
16.211 ± 0.002 Å |
| c |
7.7377 ± 0.001 Å |
| α |
90° |
| β |
99.973 ± 0.002° |
| γ |
90° |
| Cell volume |
1484.6 ± 0.3 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0514 |
| Residual factor for significantly intense reflections |
0.0476 |
| Weighted residual factors for significantly intense reflections |
0.1149 |
| Weighted residual factors for all reflections included in the refinement |
0.1174 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.149 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2216878.html