Information card for entry 2216995
| Chemical name |
(1R,4R,5R)-1,3,4-Triphenyl-7-[(<i>R</i>)-1-phenylethyl]-2-oxa-3,7-\ diazaspiro[4.5]decan-10-one |
| Formula |
C33 H32 N2 O2 |
| Calculated formula |
C33 H32 N2 O2 |
| SMILES |
C1CC(=O)[C@@]2(CN1[C@H](C)c1ccccc1)[C@@H](c1ccccc1)N(c1ccccc1)O[C@@H]2c1ccccc1 |
| Title of publication |
(1<i>R</i>,4<i>R</i>,5<i>R</i>)-1,3,4-Triphenyl-7-[(<i>R</i>)-1-phenylethyl]-2-oxa-3,7-diazaspiro[4.5]decan-10-one |
| Authors of publication |
A. Malathy; Kumar, R. Suresh; Perumal, S.; J. Suresh; Nilantha Lakshman |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
1 |
| Pages of publication |
o343 - o343 |
| a |
10.589 ± 0.005 Å |
| b |
14.582 ± 0.007 Å |
| c |
17.443 ± 0.008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2693 ± 2 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0974 |
| Residual factor for significantly intense reflections |
0.0646 |
| Weighted residual factors for significantly intense reflections |
0.1079 |
| Weighted residual factors for all reflections included in the refinement |
0.1176 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.09 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2216995.html