Information card for entry 2217034
| Chemical name |
[2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4- carboxylato(2-)](dipyrazino[2,3-<i>f</i>][1,10]phenanthroline)cobalt(II) dihydrate |
| Formula |
C33 H22 Co N10 O6 |
| Calculated formula |
C33 H22 Co N10 O6 |
| SMILES |
[Co]123(OC(=O)C4N1C(=O)NC(=O)C=4)([n]1cccc4c5nccnc5c5ccc[n]2c5c14)[n]1cccc2c4nccnc4c4ccc[n]3c4c12.O.O |
| Title of publication |
[2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylato(2{-})]bis(pyrazino[2,3-<i>f</i>][1,10]phenanthroline)cobalt(II) dihydrate |
| Authors of publication |
Rentao Wu; Jikun Li; Zebao Zheng; Wenzeng Duan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
1 |
| Pages of publication |
m100 - m100 |
| a |
15.9468 ± 0.0007 Å |
| b |
13.3765 ± 0.0006 Å |
| c |
15.5661 ± 0.0007 Å |
| α |
90° |
| β |
117.561 ± 0.001° |
| γ |
90° |
| Cell volume |
2943.6 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0353 |
| Residual factor for significantly intense reflections |
0.0302 |
| Weighted residual factors for significantly intense reflections |
0.0975 |
| Weighted residual factors for all reflections included in the refinement |
0.1048 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.997 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217034.html