Information card for entry 2217043
| Chemical name |
(Croconato-κ^2^O,O')bis(1,10-phenanthroline-κ^2^N,N')manganese(II) |
| Formula |
C29 H16 Mn N4 O5 |
| Calculated formula |
C29 H16 Mn N4 O5 |
| SMILES |
c1ccc2ccc3ccc[n]4c3c2[n]1[Mn]124(OC3=C(O2)C(=O)C(=O)C3=O)[n]2cccc3ccc4ccc[n]1c4c23 |
| Title of publication |
(Croconato-κ^2^<i>O</i>,<i>O</i>')bis(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')manganese(II) |
| Authors of publication |
Chen, Hong-Feng; Chen, Hong-Yu; Chen, Xia; Batsanov, Andrei S.; Fang, Qi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
1 |
| Pages of publication |
m172 - m172 |
| a |
14.9185 ± 0.0006 Å |
| b |
10.3749 ± 0.0004 Å |
| c |
16.0859 ± 0.0006 Å |
| α |
90° |
| β |
109.885 ± 0.001° |
| γ |
90° |
| Cell volume |
2341.3 ± 0.16 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0276 |
| Residual factor for significantly intense reflections |
0.0264 |
| Weighted residual factors for significantly intense reflections |
0.0797 |
| Weighted residual factors for all reflections included in the refinement |
0.0811 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.056 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217043.html