Information card for entry 2217101
| Chemical name |
Bis{μ-2,2'-[1,1'-(ethane-1,2- diyldinitrilo)diethylidyne]diphenolato}bis[(benzoato-κO)manganese(III)] dihydrate |
| Formula |
C50 H50 Mn2 N4 O10 |
| Calculated formula |
C50 H50 Mn2 N4 O10 |
| SMILES |
[Mn]1234(OC(=O)c5ccccc5)Oc5ccccc5C(C)=[N]2CC[N]3=C(C)c2ccccc2[O]1[Mn]123(OC(=O)c5ccccc5)Oc5ccccc5C(C)=[N]2CC[N]3=C(C)c2ccccc2[O]14.O.O |
| Title of publication |
Bis{μ-2,2'-[1,1'-(ethane-1,2-diyldinitrilo)diethylidyne]diphenolato}bis[(benzoato-κ<i>O</i>)manganese(III)] dihydrate |
| Authors of publication |
Thampidas, V. S; Radhakrishnan, T.; Pike, Robert D. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
1 |
| Pages of publication |
m150 - m151 |
| a |
12.9376 ± 0.0004 Å |
| b |
12.3983 ± 0.0004 Å |
| c |
13.847 ± 0.0004 Å |
| α |
90° |
| β |
103.702 ± 0.002° |
| γ |
90° |
| Cell volume |
2157.91 ± 0.12 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0292 |
| Residual factor for significantly intense reflections |
0.0265 |
| Weighted residual factors for significantly intense reflections |
0.0669 |
| Weighted residual factors for all reflections included in the refinement |
0.0683 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217101.html