Information card for entry 2217200
| Chemical name |
3,4-Dihydroxyphenyl 3,4,5-trimethoxybenzoate |
| Formula |
C16 H16 O7 |
| Calculated formula |
C16 H16 O7 |
| SMILES |
O(c1cc(cc(OC)c1OC)C(=O)Oc1cc(O)c(O)cc1)C |
| Title of publication |
3,4-Dihydroxyphenyl 3,4,5-trimethoxybenzoate |
| Authors of publication |
Hong, Won Ki; Heo, Ji Youn; Han, Byung Hee; Sung, Chang Keun; Kang, Sung Kwon |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
1 |
| Pages of publication |
o49 - o49 |
| a |
11.552 ± 0.002 Å |
| b |
12.817 ± 0.003 Å |
| c |
10.572 ± 0.002 Å |
| α |
90° |
| β |
105.57 ± 0.03° |
| γ |
90° |
| Cell volume |
1507.9 ± 0.6 Å3 |
| Cell temperature |
295 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0502 |
| Weighted residual factors for all reflections included in the refinement |
0.1257 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.015 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217200.html