Information card for entry 2217235
| Chemical name |
2,2',6,6'-Tetramethyl-4,4'-bipyridine |
| Formula |
C14 H16 N2 |
| Calculated formula |
C14 H16 N2 |
| SMILES |
n1c(cc(cc1C)c1cc(nc(c1)C)C)C |
| Title of publication |
2,2',6,6'-Tetramethyl-4,4'-bipyridine |
| Authors of publication |
Fu, Li-Hai |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
1 |
| Pages of publication |
o127 - o127 |
| a |
21.9827 ± 0.001 Å |
| b |
21.9827 ± 0.001 Å |
| c |
10.1569 ± 0.0006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4908.2 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
88 |
| Hermann-Mauguin space group symbol |
I 41/a :2 |
| Hall space group symbol |
-I 4ad |
| Residual factor for all reflections |
0.0715 |
| Residual factor for significantly intense reflections |
0.0514 |
| Weighted residual factors for significantly intense reflections |
0.1509 |
| Weighted residual factors for all reflections included in the refinement |
0.1645 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217235.html