Information card for entry 2217279
| Common name |
Tris(dimethyltinsulfide) |
| Chemical name |
1,1,3,3,5,5-hexamethyl-cyclo-1,3,5-tristannathiane |
| Formula |
C6 H18 S3 Sn3 |
| Calculated formula |
C6 H18 S3 Sn3 |
| SMILES |
[Sn]1(S[Sn](S[Sn](S1)(C)C)(C)C)(C)C |
| Title of publication |
Monoclinic modification of 1,1,3,3,5,5-hexamethyl-<i>cyclo</i>-1,3,5-tristannathiane |
| Authors of publication |
Nanhai Singh; Abhinav Kumar; Kieran C. Molloy; G. Kociok-Köhn |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
1 |
| Pages of publication |
m115 - m115 |
| a |
14.826 ± 0.001 Å |
| b |
12.814 ± 0.001 Å |
| c |
17.744 ± 0.001 Å |
| α |
90° |
| β |
108.706 ± 0.001° |
| γ |
90° |
| Cell volume |
3192.9 ± 0.4 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.036 |
| Residual factor for significantly intense reflections |
0.0296 |
| Weighted residual factors for significantly intense reflections |
0.0642 |
| Weighted residual factors for all reflections included in the refinement |
0.0667 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.149 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217279.html