Information card for entry 2217410
| Chemical name |
<i>cis</i>-(9<i>S</i>,10<i>S</i>)-Methyl 1-propyl-1,2,3,4-tetrahydro-β-carboline-3-carboxylate |
| Formula |
C16 H20 N2 O2 |
| Calculated formula |
C16 H20 N2 O2 |
| SMILES |
c12ccccc1c1c([C@H](CCC)N[C@@H](C1)C(=O)OC)[nH]2 |
| Title of publication |
<i>cis</i>-(9<i>S</i>,10<i>S</i>)-Methyl 1-propyl-1,2,3,4-tetrahydro-β-carboline-3-carboxylate |
| Authors of publication |
Alam, Samina; Hasan, Mashooda; Saeed, Sadaf; Fischer, Andreas; Khan, Naeema |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
o361 - o361 |
| a |
9.341 ± 0.0011 Å |
| b |
9.341 ± 0.0011 Å |
| c |
36.125 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3152.1 ± 0.7 Å3 |
| Cell temperature |
298 K |
| Number of distinct elements |
4 |
| Space group number |
96 |
| Hermann-Mauguin space group symbol |
P 43 21 2 |
| Hall space group symbol |
P 4nw 2abw |
| Residual factor for all reflections |
0.0749 |
| Residual factor for significantly intense reflections |
0.0478 |
| Weighted residual factors for significantly intense reflections |
0.1016 |
| Weighted residual factors for all reflections included in the refinement |
0.1161 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.082 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217410.html