Information card for entry 2217465
| Chemical name |
3,3'-(Ethane-1,2-diyl)bis(2-thioxo-1,3-oxazolidin-4-one) |
| Formula |
C8 H8 N2 O4 S2 |
| Calculated formula |
C8 H8 N2 O4 S2 |
| SMILES |
O=C1COC(=S)N1CCN1C(=S)OCC1=O |
| Title of publication |
3,3'-(Ethane-1,2-diyl)bis(2-thioxo-1,3-oxazolidin-4-one) |
| Authors of publication |
Ge, Chunhua; Guo, Ya'nan; Zhang, Xiangdong; Zhang, Xiaoyan; Liu, Qitao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
o506 - o506 |
| a |
6.2845 ± 0.0012 Å |
| b |
12.3252 ± 0.0019 Å |
| c |
7.08 ± 0.002 Å |
| α |
90° |
| β |
105.22 ± 0.02° |
| γ |
90° |
| Cell volume |
529.2 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0609 |
| Residual factor for significantly intense reflections |
0.0433 |
| Weighted residual factors for significantly intense reflections |
0.1169 |
| Weighted residual factors for all reflections included in the refinement |
0.1271 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.022 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217465.html