Information card for entry 2217547
| Chemical name |
6,10,16,19-Tetraoxatrispiro[4.2.2.4.2.2]nonadecane |
| Formula |
C15 H24 O4 |
| Calculated formula |
C15 H24 O4 |
| SMILES |
C1CCC2(C1)OCC1(CO2)COC2(OC1)CCCC2 |
| Title of publication |
6,10,16,19-Tetraoxatrispiro[4.2.2.4.2.2]nonadecane |
| Authors of publication |
Wang, Ji-Kui; Wang, Hai-Bo; Wu, Cong-Ren; Wang, Jin-Tang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
o498 - o498 |
| a |
25.605 ± 0.005 Å |
| b |
5.582 ± 0.0011 Å |
| c |
10.337 ± 0.002 Å |
| α |
90° |
| β |
90.22 ± 0.03° |
| γ |
90° |
| Cell volume |
1477.4 ± 0.5 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1155 |
| Residual factor for significantly intense reflections |
0.0674 |
| Weighted residual factors for significantly intense reflections |
0.1434 |
| Weighted residual factors for all reflections included in the refinement |
0.1734 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.931 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217547.html