Information card for entry 2217584
| Chemical name |
Nitrato(1,10-phenanthroline)(1<i>H</i>-1,2,4-triazole-3-carboxylato)copper(II) |
| Formula |
C15 H10 Cu N6 O5 |
| Calculated formula |
C15 H10 Cu N6 O5 |
| SMILES |
[Cu]12([n]3c(n[nH]c3)C(=O)O2)([n]2cccc3c2c2[n]1cccc2cc3)ON(=O)=O |
| Title of publication |
Nitrato(1,10-phenanthroline)(1<i>H</i>-1,2,4-triazole-3-carboxylato)copper(II) |
| Authors of publication |
Zhu, Jie; Yin, Xian-Hong; Wei, Ya-Yan; Qin, Ru-Wen; Lin, Cui-Wu; Nong, Hong-Feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
m392 - m392 |
| a |
12.3779 ± 0.0014 Å |
| b |
12.6444 ± 0.0015 Å |
| c |
10.0196 ± 0.001 Å |
| α |
90° |
| β |
107.416 ± 0.002° |
| γ |
90° |
| Cell volume |
1496.3 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.042 |
| Residual factor for significantly intense reflections |
0.0295 |
| Weighted residual factors for significantly intense reflections |
0.0749 |
| Weighted residual factors for all reflections included in the refinement |
0.086 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.064 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217584.html