Information card for entry 2217621
| Chemical name |
<i>trans</i>-(1,8-Dibenzyl-1,3,6,8,10,13- hexaazacyclotetradecane)diisonicotinatonickel(II) |
| Formula |
C34 H42 N8 Ni O4 |
| Calculated formula |
C34 H42 N8 Ni O4 |
| SMILES |
C1[NH]2CC[NH]3CN(Cc4ccccc4)C[NH]4[Ni]23([NH](CC4)CN1Cc1ccccc1)(OC(=O)c1ccncc1)OC(=O)c1ccncc1 |
| Title of publication |
<i>trans</i>-(1,8-Dibenzyl-1,3,6,8,10,13-hexaazacyclotetradecane)diisonicotinatonickel(II) |
| Authors of publication |
Jeong Hyeong Han; Bong Gon Kim; Kil Sik Min |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
m366 - m366 |
| a |
8.3418 ± 0.0005 Å |
| b |
17.3104 ± 0.0009 Å |
| c |
10.9596 ± 0.0006 Å |
| α |
90° |
| β |
91.892 ± 0.001° |
| γ |
90° |
| Cell volume |
1581.7 ± 0.15 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0693 |
| Residual factor for significantly intense reflections |
0.0621 |
| Weighted residual factors for significantly intense reflections |
0.1134 |
| Weighted residual factors for all reflections included in the refinement |
0.1157 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.293 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217621.html