Information card for entry 2217639
| Common name |
ecgonine hydrochloride |
| Chemical name |
(1R,2R,3S,5S,8S)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octane-2-carboxylic acid chloride |
| Formula |
C9 H16 Cl N O3 |
| Calculated formula |
C9 H16 Cl N O3 |
| SMILES |
[Cl-].O=C(O)[C@@H]1[C@@H]2[NH+]([C@H](C[C@@H]1O)CC2)C |
| Title of publication |
The hydrochloride salt of <small>L</small>-ecgonine, a congener of cocaine |
| Authors of publication |
Wood, Matthew R.; Brettell, Thomas A.; Thompson, Hugh W.; Lalancette, Roger A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
o525 - o525 |
| a |
6.6962 ± 0.0004 Å |
| b |
12.0519 ± 0.0008 Å |
| c |
13.0632 ± 0.0008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1054.23 ± 0.11 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.026 |
| Residual factor for significantly intense reflections |
0.026 |
| Weighted residual factors for significantly intense reflections |
0.064 |
| Weighted residual factors for all reflections included in the refinement |
0.064 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.09 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217639.html