Information card for entry 2217777
| Common name |
[1,4-dihydro-1,2,4,5-tetrazine] |
| Chemical name |
3,6-Diacetyl-1,4-diphenyl-1,4-dihydro-1,2,4,5-tetrazine |
| Formula |
C18 H16 N4 O2 |
| Calculated formula |
C18 H16 N4 O2 |
| SMILES |
C1(C(=O)C)N(c2ccccc2)N=C(C(=O)C)N(c2ccccc2)N=1 |
| Title of publication |
3,6-Diacetyl-1,4-diphenyl-1,4-dihydro-1,2,4,5-tetrazine |
| Authors of publication |
Al-Noaimi, Mousa; Haddad, Salim F. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
3 |
| Pages of publication |
o551 |
| a |
11.7853 ± 0.0006 Å |
| b |
14.7217 ± 0.0007 Å |
| c |
9.5113 ± 0.0004 Å |
| α |
90° |
| β |
92.35 ± 0.001° |
| γ |
90° |
| Cell volume |
1648.82 ± 0.13 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0643 |
| Residual factor for significantly intense reflections |
0.0393 |
| Weighted residual factors for significantly intense reflections |
0.093 |
| Weighted residual factors for all reflections included in the refinement |
0.1071 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217777.html