Information card for entry 2217797
| Chemical name |
Methyl 4-acetoxy-2-methyl-2<i>H</i>-1,2-benzothiazine-3-carboxylate 1,1-dioxide |
| Formula |
C13 H13 N O6 S |
| Calculated formula |
C13 H13 N O6 S |
| SMILES |
c12ccccc1C(=C(C(=O)OC)N(C)S2(=O)=O)OC(=O)C |
| Title of publication |
Methyl 4-acetoxy-2-methyl-2<i>H</i>-1,2-benzothiazine-3-carboxylate 1,1-dioxide |
| Authors of publication |
Ahmad, Matloob; Siddiqui, Hamid Latif; Ahmad, Saeed; Irfan Ashiq, Muhammad; Tizzard, Graham John |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
3 |
| Pages of publication |
o594 |
| a |
6.8917 ± 0.0005 Å |
| b |
24.1814 ± 0.0017 Å |
| c |
8.2861 ± 0.0005 Å |
| α |
90° |
| β |
97.876 ± 0.004° |
| γ |
90° |
| Cell volume |
1367.86 ± 0.16 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0806 |
| Residual factor for significantly intense reflections |
0.0504 |
| Weighted residual factors for significantly intense reflections |
0.1284 |
| Weighted residual factors for all reflections included in the refinement |
0.1453 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217797.html