Information card for entry 2217805
| Chemical name |
Diaqua(2,6-dioxo-1,2,3,6-tetrahydropyrimidin-3-ide-4-carboxylato-\ κ^2^N^3^,O^4^)(1,10-phenanthroline-κ^2^N,N')manganese(II) |
| Formula |
C17 H14 Mn N4 O6 |
| Calculated formula |
C17 H14 Mn N4 O6 |
| SMILES |
[Mn]12(N3C(C(=O)O2)=CC(=O)NC3=O)([n]2cccc3ccc4ccc[n]1c4c23)([OH2])[OH2] |
| Title of publication |
Diaqua(2,6-dioxo-1,2,3,6-tetrahydropyrimidin-3-ide-4-carboxylato-κ^2^<i>N</i>^3^,<i>O</i>^4^)(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')manganese(II) |
| Authors of publication |
Wu, Rentao; Huo, Yanmin; Li, Jikun; Zheng, Zebao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
3 |
| Pages of publication |
m500 - m501 |
| a |
8.3173 ± 0.0002 Å |
| b |
8.9875 ± 0.0002 Å |
| c |
11.9509 ± 0.0003 Å |
| α |
78.278 ± 0.001° |
| β |
82.91 ± 0.001° |
| γ |
74.744 ± 0.001° |
| Cell volume |
841.58 ± 0.04 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0368 |
| Residual factor for significantly intense reflections |
0.03 |
| Weighted residual factors for significantly intense reflections |
0.0681 |
| Weighted residual factors for all reflections included in the refinement |
0.0719 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217805.html