Information card for entry 2217817
| Chemical name |
8-Hydroxy-8-phenyl-2,3,7,8-tetrahydro-6<i>H</i>-1,4-dioxino[2,3-f]isoindol-6-one |
| Formula |
C16 H13 N O4 |
| Calculated formula |
C16 H13 N O4 |
| SMILES |
O1CCOc2cc3C(=O)NC(O)(c3cc12)c1ccccc1 |
| Title of publication |
8-Hydroxy-8-phenyl-2,3,7,8-tetrahydro-6<i>H</i>-1,4-dioxino[2,3-<i>f</i>]isoindol-6-one |
| Authors of publication |
Tafeenko, Viktor A.; Aslanov, Leonid A.; Khasanov, Mahmud I.; Mochalov, Sergei S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
3 |
| Pages of publication |
o548 |
| a |
8.6001 ± 0.0017 Å |
| b |
27.005 ± 0.005 Å |
| c |
5.7221 ± 0.0005 Å |
| α |
90° |
| β |
92.602 ± 0.01° |
| γ |
90° |
| Cell volume |
1327.6 ± 0.4 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0883 |
| Residual factor for significantly intense reflections |
0.0536 |
| Weighted residual factors for significantly intense reflections |
0.1298 |
| Weighted residual factors for all reflections included in the refinement |
0.1469 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217817.html