Information card for entry 2217930
| Chemical name |
5,5'-Bis(diethylamino)-2,2'-[butane-1,4- diyldioxybis(nitrilomethylidyne)]diphenol |
| Formula |
C26 H38 N4 O4 |
| Calculated formula |
C26 H38 N4 O4 |
| SMILES |
CCN(c1ccc(c(c1)O)/C=N/OCCCCO/N=C/c1ccc(cc1O)N(CC)CC)CC |
| Title of publication |
5,5'-Bis(diethylamino)-2,2'-[butane-1,4-diyldioxybis(nitrilomethylidyne)]diphenol |
| Authors of publication |
Liu, Gai-Lan; Chen, Xiao; He, Xue-Ni; Dong, Wen-Kui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
4 |
| Pages of publication |
o659 |
| a |
7.6888 ± 0.0009 Å |
| b |
13.777 ± 0.002 Å |
| c |
12.6547 ± 0.0019 Å |
| α |
90° |
| β |
101.627 ± 0.002° |
| γ |
90° |
| Cell volume |
1313 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1131 |
| Residual factor for significantly intense reflections |
0.0509 |
| Weighted residual factors for significantly intense reflections |
0.1077 |
| Weighted residual factors for all reflections included in the refinement |
0.1517 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.056 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217930.html