Information card for entry 2217956
| Chemical name |
1-Benzyl-3-(2-furylmethyl)-1,2,3,4,5,6- hexahydrospiro[benzo[<i>h</i>]quinazoline-5,1'-cyclohexane]-2,4-dione |
| Formula |
C29 H28 N2 O3 |
| Calculated formula |
C29 H28 N2 O3 |
| SMILES |
O=C1N(Cc2ccccc2)C2c3ccccc3CC3(C=2C(=O)N1Cc1ccco1)CCCCC3 |
| Title of publication |
1-Benzyl-3-(2-furylmethyl)-1,2,3,4,5,6-hexahydrospiro[benzo[<i>h</i>]quinazoline-5,1'-cyclohexane]-2,4-dione |
| Authors of publication |
Tamazyan, Rafael; Ayvazyan, Armen; Markosyan, Ashot; Gabrielyan, Siranush |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
4 |
| Pages of publication |
o748 |
| a |
10.615 ± 0.002 Å |
| b |
11.472 ± 0.002 Å |
| c |
11.923 ± 0.002 Å |
| α |
109.9 ± 0.02° |
| β |
97.95 ± 0.02° |
| γ |
115.41 ± 0.02° |
| Cell volume |
1162 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0992 |
| Residual factor for significantly intense reflections |
0.0603 |
| Weighted residual factors for significantly intense reflections |
0.1283 |
| Weighted residual factors for all reflections included in the refinement |
0.148 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.143 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217956.html