Information card for entry 2217965
| Chemical name |
7-Chloro-4-(2,5-dichlorophenyl)-1-phenyl-1<i>H</i>- thiochromeno[2,3-<i>b</i>]pyridine-2,5(3<i>H</i>,4<i>H</i>)-dione |
| Formula |
C24 H14 Cl3 N O2 S |
| Calculated formula |
C24 H14 Cl3 N O2 S |
| SMILES |
s1c2ccc(Cl)cc2c(=O)c2C(CC(=O)N(c12)c1ccccc1)c1c(Cl)ccc(Cl)c1 |
| Title of publication |
7-Chloro-4-(2,5-dichlorophenyl)-1-phenyl-1<i>H</i>-thiochromeno[2,3-<i>b</i>]pyridine-2,5(3<i>H</i>,4<i>H</i>)-dione |
| Authors of publication |
Wen, Li-Rong; Ji, Chen; Sun, Ji-Hui; Xie, Huai-Yuan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
4 |
| Pages of publication |
o670 |
| a |
13.624 ± 0.005 Å |
| b |
13.474 ± 0.005 Å |
| c |
11.861 ± 0.004 Å |
| α |
90° |
| β |
95.042 ± 0.006° |
| γ |
90° |
| Cell volume |
2168.9 ± 1.3 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.09 |
| Residual factor for significantly intense reflections |
0.0428 |
| Weighted residual factors for all reflections included in the refinement |
0.1115 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.99 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217965.html