Information card for entry 2217978
| Chemical name |
2,10-Dibromo-6,6-dimethyldibenzo[<i>d</i>,<i>f</i>][1,3]dioxepine |
| Formula |
C15 H12 Br2 O2 |
| Calculated formula |
C15 H12 Br2 O2 |
| SMILES |
Brc1ccc2c(c1)c1c(ccc(Br)c1)OC(C)(C)O2 |
| Title of publication |
2,10-Dibromo-6,6-dimethyldibenzo[<i>d</i>,<i>f</i>][1,3]dioxepine |
| Authors of publication |
Zhang, Hai-Quan; Li, Bao; Yang, Guang-Di; Ma, Yu-Guang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
4 |
| Pages of publication |
o728 |
| a |
10.8411 ± 0.0006 Å |
| b |
7.6902 ± 0.0003 Å |
| c |
16.7466 ± 0.0008 Å |
| α |
90° |
| β |
99.824 ± 0.002° |
| γ |
90° |
| Cell volume |
1375.7 ± 0.11 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0421 |
| Residual factor for significantly intense reflections |
0.0232 |
| Weighted residual factors for significantly intense reflections |
0.0557 |
| Weighted residual factors for all reflections included in the refinement |
0.0575 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.939 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217978.html