Information card for entry 2218071
| Chemical name |
3,5-dimethyl-1-(4-nitrobenzyl)pyridinium 7,7,8,8-tetracyanoquinodimethane |
| Formula |
C26 H19 N6 O2 |
| Calculated formula |
C26 H19 N6 O2 |
| SMILES |
c1(ccc(cc1)C[n+]1cc(cc(c1)C)C)N(=O)=O.C(#N)[C-](C#N)c1ccc(cc1)[C](C#N)C#N |
| Title of publication |
A charge-transfer salt, 3,5-dimethyl-1-(4-nitrobenzyl)pyridinium 7,7,8,8-tetracyanoquinodimethane |
| Authors of publication |
Wang, Min; Zhou, Hong-Bo; Chen, You-Cun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o798 |
| a |
8.098 ± 0.002 Å |
| b |
9.137 ± 0.002 Å |
| c |
16.542 ± 0.004 Å |
| α |
76.194 ± 0.003° |
| β |
75.951 ± 0.003° |
| γ |
86.933 ± 0.003° |
| Cell volume |
1153 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0542 |
| Residual factor for significantly intense reflections |
0.0456 |
| Weighted residual factors for significantly intense reflections |
0.1363 |
| Weighted residual factors for all reflections included in the refinement |
0.1439 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.002 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218071.html