Information card for entry 2218091
| Chemical name |
Trichlorido(<i>N</i>,<i>N</i>'-di-tert-butylbenzamidinato- κ^2^<i>N</i>,<i>N</i>')silicon |
| Formula |
C15 H23 Cl3 N2 Si |
| Calculated formula |
C15 H23 Cl3 N2 Si |
| SMILES |
[Si]1(Cl)(Cl)(Cl)[N](=C(N1C(C)(C)C)c1ccccc1)C(C)(C)C |
| Title of publication |
Trichlorido(<i>N</i>,<i>N</i>'-di-tert-butylbenzamidinato-κ^2^<i>N</i>,<i>N</i>')silicon |
| Authors of publication |
Lv, Lu-Dan; Li, Jun-Jun; Yang, Wei; Ren, Chun-Xia; Ding, Yu-Qiang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o870 |
| a |
6.372 ± 0.003 Å |
| b |
10.278 ± 0.004 Å |
| c |
14.229 ± 0.006 Å |
| α |
83.222 ± 0.006° |
| β |
83.227 ± 0.006° |
| γ |
84.189 ± 0.006° |
| Cell volume |
915.3 ± 0.7 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0702 |
| Residual factor for significantly intense reflections |
0.0526 |
| Weighted residual factors for significantly intense reflections |
0.1488 |
| Weighted residual factors for all reflections included in the refinement |
0.1591 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.986 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218091.html