Information card for entry 2218099
| Chemical name |
2,2'-Bi[6,6'-dimethyldibenzo[d,f][1,3]dioxepine] |
| Formula |
C30 H26 O4 |
| Calculated formula |
C30 H26 O4 |
| SMILES |
c12ccc(cc1c1c(OC(O2)(C)C)cccc1)c1ccc2c(c1)c1ccccc1OC(O2)(C)C |
| Title of publication |
2,2'-Bi[6,6'-dimethyldibenzo[<i>d</i>,<i>f</i>][1,3]dioxepine] |
| Authors of publication |
Zhang, Hai-Quan; Bao-Li; Yang, Guang-Di; Ma, Yu-Guang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o817 |
| a |
13.2938 ± 0.0016 Å |
| b |
7.32 ± 0.0017 Å |
| c |
12.7067 ± 0.0011 Å |
| α |
90° |
| β |
103.61 ± 0.03° |
| γ |
90° |
| Cell volume |
1201.8 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1092 |
| Residual factor for significantly intense reflections |
0.0373 |
| Weighted residual factors for significantly intense reflections |
0.1122 |
| Weighted residual factors for all reflections included in the refinement |
0.1258 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.806 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218099.html