Information card for entry 2218109
| Common name |
N,N'-di-(2,2'-dibenzoyloxy)benzylidenehydrazine |
| Chemical name |
2,2'-(Diazinodimethylidyne)di-<i>o</i>-phenylene dibenzoate |
| Formula |
C28 H20 N2 O4 |
| Calculated formula |
C28 H20 N2 O4 |
| SMILES |
O=C(c1ccccc1)Oc1ccccc1/C=N/N=C/c1ccccc1OC(=O)c1ccccc1 |
| Title of publication |
2,2'-Diazinodimethylidyne)di-<i>o</i>-phenylene) dibenzoate |
| Authors of publication |
Chattopadhyay, Basab; Basu, Sharmila; Ghosh, Somnath; Helliwell, Madeleine; Mukherjee, Monika |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o866 |
| a |
5.5442 ± 0.0009 Å |
| b |
7.9966 ± 0.0013 Å |
| c |
13.455 ± 0.002 Å |
| α |
73.201 ± 0.002° |
| β |
82.066 ± 0.003° |
| γ |
74.441 ± 0.002° |
| Cell volume |
548.95 ± 0.15 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0552 |
| Residual factor for significantly intense reflections |
0.0514 |
| Weighted residual factors for significantly intense reflections |
0.1301 |
| Weighted residual factors for all reflections included in the refinement |
0.1345 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.026 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218109.html
