Information card for entry 2218122
| Chemical name |
{2-[(3,5-Dichloro-2-oxidobenzylidene)amino-κ^2^N,O]-3-methylpentanoato- κO}(N,N'-dimethylformamide-κ<i>O</i>)copper(II) |
| Formula |
C16 H20 Cl2 Cu N2 O4 |
| Calculated formula |
C16 H20 Cl2 Cu N2 O4 |
| SMILES |
[Cu@]12(Oc3c(C=[N]1[C@H](C(=O)O2)[C@H](CC)C)cc(Cl)cc3Cl)[O]=CN(C)C |
| Title of publication |
{2-[(3,5-Dichloro-2-oxidobenzylidene)amino-κ^2^<i>N</i>,<i>O</i>]-3-methylpentanoato-κ<i>O</i>}(<i>N</i>,<i>N</i>'-dimethylformamide-κ<i>O</i>)copper(II) |
| Authors of publication |
Xia, Jin Hong; Liu, Zheng; Wang, Yuan; Feng, Xiao Zhen |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
m660 - m661 |
| a |
11.671 ± 0.002 Å |
| b |
27.465 ± 0.003 Å |
| c |
5.889 ± 0.0018 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1887.7 ± 0.7 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
18 |
| Hermann-Mauguin space group symbol |
P 21 21 2 |
| Hall space group symbol |
P 2 2ab |
| Residual factor for all reflections |
0.1239 |
| Residual factor for significantly intense reflections |
0.0954 |
| Weighted residual factors for significantly intense reflections |
0.2265 |
| Weighted residual factors for all reflections included in the refinement |
0.2417 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218122.html