Information card for entry 2218145
| Chemical name |
2-(2,4-Dichlorophenyl)-3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-1,3- thiazolidin-4-one |
| Formula |
C18 H13 Cl2 N3 O2 S2 |
| Calculated formula |
C18 H13 Cl2 N3 O2 S2 |
| SMILES |
Clc1ccc(C2SCC(=O)N2c2sc(nn2)c2ccc(OC)cc2)c(Cl)c1 |
| Title of publication |
2-(2,4-Dichlorophenyl)-3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-1,3-thiazolidin-4-one |
| Authors of publication |
Wan, Rong; Yin, Li-He; Han, Feng; Wang, Bin; Wang, Jin-Tang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o795 |
| a |
7.131 ± 0.0014 Å |
| b |
8.154 ± 0.0016 Å |
| c |
16.671 ± 0.003 Å |
| α |
93.19 ± 0.03° |
| β |
96.43 ± 0.03° |
| γ |
105.89 ± 0.03° |
| Cell volume |
922.7 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1082 |
| Residual factor for significantly intense reflections |
0.0674 |
| Weighted residual factors for significantly intense reflections |
0.1653 |
| Weighted residual factors for all reflections included in the refinement |
0.2113 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218145.html