Information card for entry 2218155
| Chemical name |
Dichloridobis(5-<i>m</i>-tolyl-1,3,4-thiadiazol-2-ylamine-κN^3^)zinc(II) |
| Formula |
C18 H18 Cl2 N6 S2 Zn |
| Calculated formula |
C18 H18 Cl2 N6 S2 Zn |
| SMILES |
[Zn](Cl)(Cl)([n]1nc(sc1N)c1cc(C)ccc1)[n]1nc(sc1N)c1cccc(C)c1 |
| Title of publication |
Dichloridobis(5-<i>m</i>-tolyl-1,3,4-thiadiazol-2-ylamine-κ<i>N</i>^3^)zinc(II) |
| Authors of publication |
Wang, Bin; Wan, Rong; Yin, Li-He; Han, Feng; Wang, Jin-Tang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
m692 - m693 |
| a |
10.826 ± 0.002 Å |
| b |
11.233 ± 0.002 Å |
| c |
17.892 ± 0.004 Å |
| α |
90° |
| β |
90.1 ± 0.03° |
| γ |
90° |
| Cell volume |
2175.8 ± 0.7 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1361 |
| Residual factor for significantly intense reflections |
0.0863 |
| Weighted residual factors for significantly intense reflections |
0.1786 |
| Weighted residual factors for all reflections included in the refinement |
0.2114 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.019 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218155.html