Information card for entry 2218169
| Chemical name |
3,6-Dichloro-<i>N</i>-(4,6-dichloropyrimidin-2-yl)picolinamide |
| Formula |
C10 H4 Cl4 N4 O |
| Calculated formula |
C10 H4 Cl4 N4 O |
| SMILES |
Clc1c(nc(Cl)cc1)C(=O)Nc1nc(Cl)cc(Cl)n1 |
| Title of publication |
3,6-Dichloro-<i>N</i>-(4,6-dichloropyrimidin-2-yl)picolinamide |
| Authors of publication |
Zhang, Shan-Shan; Zhuang, Yue; Yin, Xian-Hong; Zhao, Kai; Lin, Cui-Wu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o871 |
| a |
10.9313 ± 0.0013 Å |
| b |
13.3682 ± 0.0014 Å |
| c |
9.3846 ± 0.001 Å |
| α |
90° |
| β |
112.576 ± 0.001° |
| γ |
90° |
| Cell volume |
1266.3 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0398 |
| Residual factor for significantly intense reflections |
0.0329 |
| Weighted residual factors for significantly intense reflections |
0.0896 |
| Weighted residual factors for all reflections included in the refinement |
0.0963 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.023 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218169.html