Information card for entry 2218175
| Chemical name |
Methyl 2-(2-hydroxybenzylideneamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| Formula |
C17 H17 N O3 S |
| Calculated formula |
C17 H17 N O3 S |
| SMILES |
s1c(/N=C/c2c(O)cccc2)c(C(=O)OC)c2CCCCc12 |
| Title of publication |
Methyl 2-(2-hydroxybenzylideneamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| Authors of publication |
Akkurt, Mehmet; Karaca, Selvi; Asiri, Abdullah Mohamed; Büyükgüngör, Orhan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o869 |
| a |
7.6107 ± 0.0004 Å |
| b |
21.2154 ± 0.0009 Å |
| c |
11.1827 ± 0.0007 Å |
| α |
90° |
| β |
123.342 ± 0.004° |
| γ |
90° |
| Cell volume |
1508.41 ± 0.16 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.06 |
| Residual factor for significantly intense reflections |
0.0447 |
| Weighted residual factors for significantly intense reflections |
0.1143 |
| Weighted residual factors for all reflections included in the refinement |
0.1211 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.986 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218175.html