Information card for entry 2218207
| Chemical name |
1,2-Bis[5-(4-cyanophenyl)-2-methyl-3-thienyl]-3,3,4,4,5,5-hexafluorocyclopent- 1-ene |
| Formula |
C29 H16 F6 N2 S2 |
| Calculated formula |
C29 H16 F6 N2 S2 |
| SMILES |
N#Cc1ccc(cc1)c1cc(c(s1)C)C1=C(c2cc(sc2C)c2ccc(cc2)C#N)C(C(C1(F)F)(F)F)(F)F |
| Title of publication |
1,2-Bis[5-(4-cyanophenyl)-2-methyl-3-thienyl]-3,3,4,4,5,5-hexafluorocyclopent-1-ene: a photochromic diarylethene compound |
| Authors of publication |
Liu, Gang; Tu, Qidong; Zhang, Qing; Fan, Congbin; Yang, Tianshe |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o938 |
| a |
24.987 ± 0.01 Å |
| b |
9.276 ± 0.004 Å |
| c |
10.774 ± 0.004 Å |
| α |
90° |
| β |
95.911 ± 0.007° |
| γ |
90° |
| Cell volume |
2483.9 ± 1.7 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0645 |
| Residual factor for significantly intense reflections |
0.057 |
| Weighted residual factors for significantly intense reflections |
0.1394 |
| Weighted residual factors for all reflections included in the refinement |
0.1454 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.065 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218207.html