Information card for entry 2218309
| Chemical name |
<i>N</i>-(3,4-Difluorophenyl)-3,4-dimethoxybenzenesulfonamide |
| Formula |
C14 H13 F2 N O4 S |
| Calculated formula |
C14 H13 F2 N O4 S |
| SMILES |
Fc1cc(ccc1F)NS(=O)(=O)c1cc(c(cc1)OC)OC |
| Title of publication |
<i>N</i>-(3,4-Difluorophenyl)-3,4-dimethoxybenzenesulfonamide |
| Authors of publication |
You, Hyon Pil; Han, Byung Hee; Kang, Sung Kwon; Sung, Chang Keun; Kang, Sang Ook |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
6 |
| Pages of publication |
o994 |
| a |
12.2886 ± 0.001 Å |
| b |
8.5662 ± 0.0007 Å |
| c |
14.5546 ± 0.0012 Å |
| α |
90° |
| β |
109.655 ± 0.002° |
| γ |
90° |
| Cell volume |
1442.8 ± 0.2 Å3 |
| Cell temperature |
295 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0438 |
| Weighted residual factors for all reflections included in the refinement |
0.1262 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.994 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218309.html