Information card for entry 2218323
| Chemical name |
{2-[(5-Bromo-2-oxidobenzylidene)amino-κ^2^N,O]-3-methylpentanoato-κO}(1,10- phenanthroline-κ^2^<i>N</i>,<i>N'</i>)copper(II) |
| Formula |
C25 H26 Br Cu N3 O5 |
| Calculated formula |
C25 H26 Br Cu N3 O5 |
| SMILES |
[Cu]123([N]([C@H](C(=O)O2)[C@H](CC)C)=Cc2c(O3)ccc(Br)c2)[n]2cccc3c2c2[n]1cccc2cc3.O.O |
| Title of publication |
{2-[(5-Bromo-2-oxidobenzylidene)amino-κ^2^<i>N</i>,<i>O</i>]-3-methylpentanoato-κ<i>O</i>}(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')copper(II) dihydrate |
| Authors of publication |
Liu, Zheng; Wang, Yong-Liao; Wang, Yuan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
6 |
| Pages of publication |
m760 |
| a |
10.6184 ± 0.0018 Å |
| b |
6.052 ± 0.0016 Å |
| c |
19.777 ± 0.003 Å |
| α |
90° |
| β |
93.481 ± 0.002° |
| γ |
90° |
| Cell volume |
1268.6 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.1097 |
| Residual factor for significantly intense reflections |
0.0543 |
| Weighted residual factors for significantly intense reflections |
0.0668 |
| Weighted residual factors for all reflections included in the refinement |
0.0742 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.962 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218323.html